CAS 1353980-66-1
:2-Amino-N-(1-methylethyl)-N-[[3-(methylthio)-2-pyrazinyl]methyl]acetamide
Description:
2-Amino-N-(1-methylethyl)-N-[[3-(methylthio)-2-pyrazinyl]methyl]acetamide, identified by its CAS number 1353980-66-1, is a chemical compound characterized by its complex structure, which includes an amino group, an acetamide moiety, and a pyrazine ring substituted with a methylthio group. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amino and acetamide functional groups. The presence of the pyrazine ring may impart specific biological activity, making it of interest in pharmaceutical research. Additionally, the isopropyl group (1-methylethyl) may influence the compound's lipophilicity and overall pharmacokinetic profile. As with many organic compounds, its stability, reactivity, and interactions with other substances will depend on environmental conditions such as pH and temperature. Further studies would be necessary to elucidate its specific applications and biological effects.
Formula:C11H18N4OS
InChI:InChI=1S/C11H18N4OS/c1-8(2)15(10(16)6-12)7-9-11(17-3)14-5-4-13-9/h4-5,8H,6-7,12H2,1-3H3
InChI key:InChIKey=YJTLOMOSBIBRFR-UHFFFAOYSA-N
SMILES:C(N(C(CN)=O)C(C)C)C=1C(SC)=NC=CN1
Synonyms:- Acetamide, 2-amino-N-(1-methylethyl)-N-[[3-(methylthio)-2-pyrazinyl]methyl]-
- 2-Amino-N-(1-methylethyl)-N-[[3-(methylthio)-2-pyrazinyl]methyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.