CAS 1353980-69-4
:N<sup>1</sup>-(1-Methylethyl)-N<sup>1</sup>-[(1-methyl-3-piperidinyl)methyl]-1,2-ethanediamine
Description:
N1-(1-Methylethyl)-N1-[(1-methyl-3-piperidinyl)methyl]-1,2-ethanediamine is a chemical compound characterized by its complex structure, which includes an ethylenediamine backbone substituted with various alkyl and piperidine groups. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals. Additionally, the branched alkyl groups may enhance lipophilicity, affecting the compound's distribution in biological systems. Its molecular structure indicates that it could participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. As with many amines, it may also exhibit varying degrees of toxicity and reactivity, necessitating careful handling and assessment in laboratory settings. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and material science.
Formula:C12H27N3
InChI:InChI=1S/C12H27N3/c1-11(2)15(8-6-13)10-12-5-4-7-14(3)9-12/h11-12H,4-10,13H2,1-3H3
InChI key:InChIKey=BJHZSMSLDOULJM-UHFFFAOYSA-N
SMILES:C(N(CCN)C(C)C)C1CN(C)CCC1
Synonyms:- N1-(1-Methylethyl)-N1-[(1-methyl-3-piperidinyl)methyl]-1,2-ethanediamine
- 1,2-Ethanediamine, N1-(1-methylethyl)-N1-[(1-methyl-3-piperidinyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.