CymitQuimica logo

CAS 1353980-94-5

:

3-(Cyclopropylmethylamino)-1-piperidineethanol

Description:
3-(Cyclopropylmethylamino)-1-piperidineethanol is a chemical compound characterized by its unique structure, which includes a piperidine ring and a cyclopropylmethylamino group. This compound features a hydroxyl group (-OH) attached to the piperidine, contributing to its potential as a bioactive molecule. The presence of the cyclopropyl group may influence its pharmacological properties, such as receptor binding affinity and metabolic stability. Typically, compounds like this are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. The molecular interactions and solubility characteristics of this compound can be influenced by its functional groups, which may affect its bioavailability and efficacy. Additionally, the compound's stereochemistry and conformation can play significant roles in its biological activity. As with many amines and alcohols, it may exhibit basic properties and participate in hydrogen bonding, which can further influence its behavior in biological systems.
Formula:C11H22N2O
InChI:InChI=1S/C11H22N2O/c1-12(10-4-5-10)11-3-2-6-13(9-11)7-8-14/h10-11,14H,2-9H2,1H3
InChI key:InChIKey=BVRBGLIDWYVYKO-UHFFFAOYSA-N
SMILES:N(C)(C1CN(CCO)CCC1)C2CC2
Synonyms:
  • 1-Piperidineethanol, 3-(cyclopropylmethylamino)-
  • 3-(Cyclopropylmethylamino)-1-piperidineethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.