CAS 1353980-98-9
:N-Methyl-N-[1-(phenylmethyl)-3-piperidinyl]glycine
Description:
N-Methyl-N-[1-(phenylmethyl)-3-piperidinyl]glycine, identified by its CAS number 1353980-98-9, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a piperidine ring, which contributes to its cyclic structure and potential biological activity. The presence of the N-methyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. The phenylmethyl group attached to the piperidine ring may impart additional hydrophobic characteristics, which can affect the compound's interaction with various biological targets. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may modulate neurotransmitter systems. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. As with many compounds in this category, understanding its pharmacokinetics and pharmacodynamics is crucial for evaluating its therapeutic potential.
Formula:C15H22N2O2
InChI:InChI=1S/C15H22N2O2/c1-16(12-15(18)19)14-8-5-9-17(11-14)10-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3,(H,18,19)
InChI key:InChIKey=RYNHWJGZKZNKOM-UHFFFAOYSA-N
SMILES:C(N1CC(N(CC(O)=O)C)CCC1)C2=CC=CC=C2
Synonyms:- N-Methyl-N-[1-(phenylmethyl)-3-piperidinyl]glycine
- Glycine, N-methyl-N-[1-(phenylmethyl)-3-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.