CymitQuimica logo

CAS 1353980-99-0

:

2-[(2-Hydroxyethyl)methylamino]-1-(2-thiazolyl)ethanone

Description:
2-[(2-Hydroxyethyl)methylamino]-1-(2-thiazolyl)ethanone is a chemical compound characterized by its unique structural features, which include a thiazole ring, a hydroxyl group, and an amine functional group. This compound typically exhibits properties associated with both amines and ketones, such as potential basicity due to the presence of the amino group and reactivity typical of carbonyl compounds. The thiazole moiety contributes to its biological activity, often enhancing its interaction with biological targets. Solubility in polar solvents is likely due to the hydroxyl group, while the thiazole ring may impart some hydrophobic characteristics. The compound may also exhibit moderate to high stability under standard conditions, although specific stability can depend on environmental factors such as pH and temperature. Its potential applications could span pharmaceuticals, agrochemicals, or as a biochemical probe, given the presence of functional groups that facilitate interactions with various biological systems. Overall, this compound represents a versatile structure with implications in medicinal chemistry and related fields.
Formula:C8H12N2O2S
InChI:InChI=1S/C8H12N2O2S/c1-10(3-4-11)6-7(12)8-9-2-5-13-8/h2,5,11H,3-4,6H2,1H3
InChI key:InChIKey=ABYGJSOJVOZWSO-UHFFFAOYSA-N
SMILES:C(CN(CCO)C)(=O)C1=NC=CS1
Synonyms:
  • Ethanone, 2-[(2-hydroxyethyl)methylamino]-1-(2-thiazolyl)-
  • 2-[(2-Hydroxyethyl)methylamino]-1-(2-thiazolyl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.