CAS 1353981-06-2

1,1-Dimethylethyl N-[1-(2-aminoacetyl)-3-piperidinyl]-N-(1-methylethyl)carbamate

Description:

1,1-Dimethylethyl N-[1-(2-aminoacetyl)-3-piperidinyl]-N-(1-methylethyl)carbamate, identified by its CAS number 1353981-06-2, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by the presence of a piperidine ring, which contributes to its potential biological activity. The compound includes functional groups such as amine and carbamate, which are known for their roles in various chemical reactions and biological interactions. Its molecular structure suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a pharmacological agent. The presence of dimethyl and isopropyl groups indicates steric hindrance, which can influence its reactivity and interaction with biological targets. While specific physical properties such as solubility, melting point, and boiling point are not detailed here, compounds of this nature typically exhibit moderate to high polarity, affecting their behavior in biological systems. Further studies would be necessary to elucidate its full range of characteristics and potential applications.

Formula: C₁₅H₂₉N₃O₃

InChI: InChI=1S/C15H29N3O3/c1-11(2)18(14(20)21-15(3,4)5)12-7-6-8-17(10-12)13(19)9-16/h11-12H,6-10,16H2,1-5H3

InChI key: InChIKey=VBFPJQJIDUCNOW-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)(C(C)C)C1CN(C(CN)=O)CCC1

Synonyms:

• 1,1-Dimethylethyl N-[1-(2-aminoacetyl)-3-piperidinyl]-N-(1-methylethyl)carbamate
• Carbamic acid, N-[1-(2-aminoacetyl)-3-piperidinyl]-N-(1-methylethyl)-, 1,1-dimethylethyl ester