CymitQuimica logo

CAS 1353981-16-4

:

2-[(1-Methylethyl)[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]amino]ethanol

Description:
The chemical substance known as 2-[(1-Methylethyl)[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]amino]ethanol, with the CAS number 1353981-16-4, is a complex organic compound characterized by its multi-functional structure. It features a pyrrolidine ring, which contributes to its potential biological activity, and an ethanolamine moiety that may influence its solubility and reactivity. The presence of both an isopropyl group and a phenylmethyl group suggests that the compound may exhibit significant steric hindrance, potentially affecting its interaction with biological targets. This compound may be of interest in medicinal chemistry due to its structural features that could relate to pharmacological properties. Additionally, the presence of nitrogen atoms in the structure indicates that it may engage in hydrogen bonding, which can affect its physical properties such as melting point and solubility in various solvents. Overall, this compound's unique structure positions it as a candidate for further research in drug development and related fields.
Formula:C17H28N2O
InChI:InChI=1S/C17H28N2O/c1-15(2)18(11-12-20)14-17-9-6-10-19(17)13-16-7-4-3-5-8-16/h3-5,7-8,15,17,20H,6,9-14H2,1-2H3
InChI key:InChIKey=JZTICFJSVCLETF-UHFFFAOYSA-N
SMILES:C(N(CCO)C(C)C)C1N(CC2=CC=CC=C2)CCC1
Synonyms:
  • Ethanol, 2-[(1-methylethyl)[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]amino]-
  • 2-[(1-Methylethyl)[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]amino]ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.