CAS 1353981-35-7
:2-[(2-Aminoethyl)methylamino]-1-(2-furanyl)ethanone
Description:
2-[(2-Aminoethyl)methylamino]-1-(2-furanyl)ethanone, identified by its CAS number 1353981-35-7, is a chemical compound characterized by its unique structure that includes a furan ring, an aminoethyl group, and a ketone functional group. This compound typically exhibits properties associated with both amines and ketones, such as potential basicity due to the amino groups and reactivity due to the carbonyl group. The presence of the furan moiety may impart additional characteristics, such as aromaticity and potential for electrophilic substitution reactions. In terms of solubility, compounds containing furan and amino groups often show good solubility in polar solvents, which can influence their behavior in biological systems. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Overall, its structural features suggest a versatile compound with potential applications in various chemical and pharmaceutical contexts.
Formula:C9H14N2O2
InChI:InChI=1S/C9H14N2O2/c1-11(5-4-10)7-8(12)9-3-2-6-13-9/h2-3,6H,4-5,7,10H2,1H3
InChI key:InChIKey=YWTGYALABBALFN-UHFFFAOYSA-N
SMILES:C(CN(CCN)C)(=O)C1=CC=CO1
Synonyms:- 2-[(2-Aminoethyl)methylamino]-1-(2-furanyl)ethanone
- Ethanone, 2-[(2-aminoethyl)methylamino]-1-(2-furanyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.