CAS 1353981-46-0

Phenylmethyl 2-[(ethylamino)methyl]-1-pyrrolidinecarboxylate

Description:

Phenylmethyl 2-[(ethylamino)methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1353981-46-0, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance typically exhibits characteristics such as a complex molecular structure featuring a pyrrolidine ring, which contributes to its potential biological activity. The presence of the ethylamino group suggests that it may interact with biological systems, possibly influencing neurotransmitter pathways. Its ester functional group indicates that it may undergo hydrolysis, leading to the release of the corresponding carboxylic acid and alcohol. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, due to its structural features, it may possess pharmacological properties, making it of interest in medicinal chemistry. However, specific data regarding its toxicity, pharmacokinetics, and therapeutic applications would require further investigation through empirical studies and literature review.

Formula: C₁₅H₂₂N₂O₂

InChI: InChI=1S/C15H22N2O2/c1-2-16-11-14-9-6-10-17(14)15(18)19-12-13-7-4-3-5-8-13/h3-5,7-8,14,16H,2,6,9-12H2,1H3

InChI key: InChIKey=VPMJDLCXKBRYQC-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2C(CNCC)CCC2

Synonyms:

• Phenylmethyl 2-[(ethylamino)methyl]-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 2-[(ethylamino)methyl]-, phenylmethyl ester