CAS 1353981-55-1

N1-Methyl-N1-[[1-(phenylmethyl)-3-pyrrolidinyl]methyl]-1,2-ethanediamine

Description:

N1-Methyl-N1-[[1-(phenylmethyl)-3-pyrrolidinyl]methyl]-1,2-ethanediamine, identified by its CAS number 1353981-55-1, is a chemical compound that belongs to the class of substituted amines. This substance features a complex structure characterized by a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and an ethylenediamine backbone. The presence of a phenylmethyl group contributes to its lipophilicity, potentially influencing its pharmacokinetic properties. The methylation at the nitrogen atoms suggests that it may exhibit basic properties, allowing it to interact with various biological targets. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of neuroscience and pharmacology, due to their ability to modulate neurotransmitter systems. However, specific biological activity, toxicity, and safety profiles would require further empirical studies to establish its practical applications and regulatory status. As with any chemical, proper handling and safety precautions are essential when working with this compound in a laboratory setting.

Formula: C₁₅H₂₅N₃

InChI: InChI=1S/C15H25N3/c1-17(10-8-16)11-15-7-9-18(13-15)12-14-5-3-2-4-6-14/h2-6,15H,7-13,16H2,1H3

InChI key: InChIKey=HMTWBNWPPYHXGB-UHFFFAOYSA-N

SMILES: C(N1CC(CN(CCN)C)CC1)C2=CC=CC=C2

Synonyms:

• 1,2-Ethanediamine, N1-methyl-N1-[[1-(phenylmethyl)-3-pyrrolidinyl]methyl]-
• N1-Methyl-N1-[[1-(phenylmethyl)-3-pyrrolidinyl]methyl]-1,2-ethanediamine