CAS 1353981-60-8
:2-Amino-N-methyl-N-[2-oxo-2-(2-thienyl)ethyl]acetamide
Description:
2-Amino-N-methyl-N-[2-oxo-2-(2-thienyl)ethyl]acetamide is a chemical compound characterized by its unique structure, which includes an amino group, a methyl group, and a thienyl moiety. This compound features an acetamide functional group, contributing to its potential as a bioactive molecule. The presence of the thienyl ring suggests that it may exhibit interesting electronic properties and biological activities, possibly making it relevant in medicinal chemistry. The compound's molecular structure indicates it may participate in hydrogen bonding due to the amino and carbonyl groups, which can influence its solubility and reactivity. Additionally, the presence of the thienyl group may enhance its lipophilicity, affecting its pharmacokinetic properties. Overall, 2-Amino-N-methyl-N-[2-oxo-2-(2-thienyl)ethyl]acetamide is a compound of interest for further research, particularly in the fields of organic synthesis and drug development, although specific biological activities and applications would require empirical investigation.
Formula:C9H12N2O2S
InChI:InChI=1S/C9H12N2O2S/c1-11(9(13)5-10)6-7(12)8-3-2-4-14-8/h2-4H,5-6,10H2,1H3
InChI key:InChIKey=KRDYOJWNHKKWMR-UHFFFAOYSA-N
SMILES:C(CN(C(CN)=O)C)(=O)C1=CC=CS1
Synonyms:- 2-Amino-N-methyl-N-[2-oxo-2-(2-thienyl)ethyl]acetamide
- Acetamide, 2-amino-N-methyl-N-[2-oxo-2-(2-thienyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.