CAS 1353981-66-4
:Phenylmethyl N-[4-[(2-hydroxyethyl)(1-methylethyl)amino]cyclohexyl]carbamate
Description:
Phenylmethyl N-[4-[(2-hydroxyethyl)(1-methylethyl)amino]cyclohexyl]carbamate, identified by its CAS number 1353981-66-4, is a chemical compound that belongs to the class of carbamates. This substance features a phenylmethyl group and a cyclohexyl moiety, which contribute to its structural complexity and potential biological activity. The presence of a hydroxyethyl group and an isopropylamine component suggests that it may exhibit properties relevant to medicinal chemistry, possibly influencing its solubility and interaction with biological targets. Carbamates are known for their diverse applications, including use as pesticides, pharmaceuticals, and in the synthesis of various organic compounds. The specific characteristics of this compound, such as its melting point, boiling point, solubility, and reactivity, would typically be determined through experimental methods. Additionally, its safety profile, including toxicity and environmental impact, would be assessed in accordance with regulatory guidelines. Overall, this compound's unique structure may offer insights into its potential applications in various fields, particularly in drug development.
Formula:C19H30N2O3
InChI:InChI=1S/C19H30N2O3/c1-15(2)21(12-13-22)18-10-8-17(9-11-18)20-19(23)24-14-16-6-4-3-5-7-16/h3-7,15,17-18,22H,8-14H2,1-2H3,(H,20,23)
InChI key:InChIKey=XBJQBZOXZFLQJW-UHFFFAOYSA-N
SMILES:N(CCO)(C(C)C)C1CCC(NC(OCC2=CC=CC=C2)=O)CC1
Synonyms:- Carbamic acid, N-[4-[(2-hydroxyethyl)(1-methylethyl)amino]cyclohexyl]-, phenylmethyl ester
- Phenylmethyl N-[4-[(2-hydroxyethyl)(1-methylethyl)amino]cyclohexyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.