CAS 1353982-05-4

3-[(Acetylmethylamino)methyl]-1-piperidineacetic acid

Description:

3-[(Acetylmethylamino)methyl]-1-piperidineacetic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an acetic acid functional group, contributing to its acidic properties, and an acetylmethylamino group that enhances its potential for hydrogen bonding and reactivity. The presence of the piperidine moiety suggests that it may exhibit basic characteristics due to the nitrogen atom, which can accept protons. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in drug design and synthesis. As with many chemical substances, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use.

Formula: C₁₁H₂₀N₂O₃

InChI: InChI=1S/C11H20N2O3/c1-9(14)12(2)6-10-4-3-5-13(7-10)8-11(15)16/h10H,3-8H2,1-2H3,(H,15,16)

InChI key: InChIKey=ONUQQOBKWAIGGC-UHFFFAOYSA-N

SMILES: C(N(C(C)=O)C)C1CN(CC(O)=O)CCC1

Synonyms:

• 3-[(Acetylmethylamino)methyl]-1-piperidineacetic acid
• 1-Piperidineacetic acid, 3-[(acetylmethylamino)methyl]-