CAS 1353982-33-8

2-Amino-N-methyl-N-[(4-nitrophenyl)methyl]acetamide

Description:

2-Amino-N-methyl-N-[(4-nitrophenyl)methyl]acetamide is an organic compound characterized by its amide functional group, which features an amino group and a methyl group attached to the nitrogen atom. The presence of a 4-nitrophenyl group indicates that the compound has a nitro substituent on a phenyl ring, contributing to its potential reactivity and polarity. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of both polar amine and carbonyl functional groups. Its molecular structure suggests it may participate in hydrogen bonding, influencing its physical properties such as melting and boiling points. Additionally, the nitro group can impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and materials science. Safety and handling precautions should be observed, as nitro compounds can be sensitive and potentially hazardous. Overall, 2-Amino-N-methyl-N-[(4-nitrophenyl)methyl]acetamide represents a complex molecule with diverse potential applications in synthetic chemistry.

Formula: C₁₀H₁₃N₃O₃

InChI: InChI=1S/C10H13N3O3/c1-12(10(14)6-11)7-8-2-4-9(5-3-8)13(15)16/h2-5H,6-7,11H2,1H3

InChI key: InChIKey=VPTGOJDJEPLSCJ-UHFFFAOYSA-N

SMILES: C(N(C(CN)=O)C)C1=CC=C(N(=O)=O)C=C1

Synonyms:

• Acetamide, 2-amino-N-methyl-N-[(4-nitrophenyl)methyl]-
• 2-Amino-N-methyl-N-[(4-nitrophenyl)methyl]acetamide