CAS 1353982-53-2
:N<sup>1</sup>-[1-(3-Chlorophenyl)ethyl]-N<sup>1</sup>-(1-methylethyl)-1,2-ethanediamine
Description:
N1-[1-(3-Chlorophenyl)ethyl]-N1-(1-methylethyl)-1,2-ethanediamine, identified by its CAS number 1353982-53-2, is a chemical compound characterized by its dual amine functional groups and a substituted ethyl chain. This compound features a 3-chlorophenyl group, which contributes to its aromatic properties and potential biological activity. The presence of the isopropyl group (1-methylethyl) enhances its steric bulk, which may influence its interaction with biological targets. As a diamine, it can participate in various chemical reactions, including those involving nucleophilic substitution or coordination with metal ions. The structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent polarity. Overall, this compound's unique structure may provide insights into its potential uses and mechanisms of action in biological systems.
Formula:C13H21ClN2
InChI:InChI=1S/C13H21ClN2/c1-10(2)16(8-7-15)11(3)12-5-4-6-13(14)9-12/h4-6,9-11H,7-8,15H2,1-3H3
InChI key:InChIKey=VDYAPNYBEUJYCT-UHFFFAOYSA-N
SMILES:C(N(CCN)C(C)C)(C)C1=CC(Cl)=CC=C1
Synonyms:- N1-[1-(3-Chlorophenyl)ethyl]-N1-(1-methylethyl)-1,2-ethanediamine
- 1,2-Ethanediamine, N1-[1-(3-chlorophenyl)ethyl]-N1-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.