CAS 1353982-60-1

Phenylmethyl 4-(2-aminoethyl)-3-methyl-1-piperazinecarboxylate

Description:

Phenylmethyl 4-(2-aminoethyl)-3-methyl-1-piperazinecarboxylate, identified by its CAS number 1353982-60-1, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered cyclic amine, and is characterized by the presence of a carboxylate group, an aminoethyl side chain, and a phenylmethyl moiety. The molecular structure suggests potential biological activity, particularly in the realm of pharmacology, where piperazine derivatives are often explored for their therapeutic properties. The compound may exhibit solubility in polar solvents due to the presence of amino and carboxylate functional groups, while the phenylmethyl group may contribute to hydrophobic interactions. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be of interest in medicinal chemistry for its potential applications in drug development. As with any chemical substance, safety data and handling precautions should be consulted prior to use.

Formula: C₁₅H₂₃N₃O₂

InChI: InChI=1S/C15H23N3O2/c1-13-11-18(10-9-17(13)8-7-16)15(19)20-12-14-5-3-2-4-6-14/h2-6,13H,7-12,16H2,1H3

InChI key: InChIKey=OBZIIZJGPSDKPH-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2CC(C)N(CCN)CC2

Synonyms:

• 1-Piperazinecarboxylic acid, 4-(2-aminoethyl)-3-methyl-, phenylmethyl ester
• Phenylmethyl 4-(2-aminoethyl)-3-methyl-1-piperazinecarboxylate