CAS 1353982-64-5
:4-[(1-Methylethyl)(phenylmethyl)amino]-1-piperidineacetic acid
Description:
4-[(1-Methylethyl)(phenylmethyl)amino]-1-piperidineacetic acid, identified by its CAS number 1353982-64-5, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of an amino group attached to a piperidine structure, along with an acetic acid moiety, contributing to its potential biological activity. The presence of both isopropyl and benzyl groups on the nitrogen atom suggests that it may exhibit lipophilic properties, which can influence its solubility and permeability in biological systems. The structural complexity indicates potential interactions with various biological targets, making it of interest in medicinal chemistry. Additionally, the compound's functional groups may confer specific reactivity and stability characteristics, which are important for its application in pharmaceutical development. Overall, this compound's unique structure positions it as a candidate for further investigation in drug discovery and development processes.
Formula:C17H26N2O2
InChI:InChI=1S/C17H26N2O2/c1-14(2)19(12-15-6-4-3-5-7-15)16-8-10-18(11-9-16)13-17(20)21/h3-7,14,16H,8-13H2,1-2H3,(H,20,21)
InChI key:InChIKey=CHXZVFNJVPUPGY-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(C(C)C)C2CCN(CC(O)=O)CC2
Synonyms:- 4-[(1-Methylethyl)(phenylmethyl)amino]-1-piperidineacetic acid
- 1-Piperidineacetic acid, 4-[(1-methylethyl)(phenylmethyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.