CymitQuimica logo

CAS 1353982-94-1

:

2-[(1-Isoquinolinylmethyl)methylamino]ethanol

Description:
2-[(1-Isoquinolinylmethyl)methylamino]ethanol is a chemical compound characterized by its unique structure, which includes an isoquinoline moiety linked to a methylamino group and an ethanol backbone. This compound features a nitrogen atom in its structure, contributing to its potential as a ligand in various biochemical interactions. The presence of the isoquinoline ring suggests possible biological activity, as isoquinolines are known for their diverse pharmacological properties, including antitumor and antimicrobial effects. The hydroxyl group in the ethanol portion enhances its solubility in polar solvents, which is advantageous for biological applications. Additionally, the compound's ability to form hydrogen bonds due to the hydroxyl and amino groups may influence its reactivity and interaction with biological targets. Overall, 2-[(1-Isoquinolinylmethyl)methylamino]ethanol presents interesting characteristics that could be explored in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C13H16N2O
InChI:InChI=1S/C13H16N2O/c1-15(8-9-16)10-13-12-5-3-2-4-11(12)6-7-14-13/h2-7,16H,8-10H2,1H3
InChI key:InChIKey=LQJCWAFGUFYXSK-UHFFFAOYSA-N
SMILES:C(N(CCO)C)C=1C2=C(C=CN1)C=CC=C2
Synonyms:
  • 2-[(1-Isoquinolinylmethyl)methylamino]ethanol
  • Ethanol, 2-[(1-isoquinolinylmethyl)methylamino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.