CAS 1353983-04-6

2-Chloro-N-ethyl-N-[[4-(methylthio)phenyl]methyl]acetamide

Description:

2-Chloro-N-ethyl-N-[[4-(methylthio)phenyl]methyl]acetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro group, an ethyl amine moiety, and a phenyl ring substituted with a methylthio group, which contributes to its unique properties. The presence of the acetamide functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic (phenyl and methylthio) and hydrophilic (acetamide) components. Its molecular structure suggests potential applications in medicinal chemistry, possibly as a pharmaceutical intermediate or a bioactive compound. The chloro substituent may also impart specific reactivity, making it a candidate for further chemical modifications. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact. Overall, the characteristics of this compound make it a subject of interest in various chemical research fields.

Formula: C₁₂H₁₆ClNOS

InChI: InChI=1S/C12H16ClNOS/c1-3-14(12(15)8-13)9-10-4-6-11(16-2)7-5-10/h4-7H,3,8-9H2,1-2H3

InChI key: InChIKey=FNZIBSHRBHBBNX-UHFFFAOYSA-N

SMILES: C(N(C(CCl)=O)CC)C1=CC=C(SC)C=C1

Synonyms:

• Acetamide, 2-chloro-N-ethyl-N-[[4-(methylthio)phenyl]methyl]-
• 2-Chloro-N-ethyl-N-[[4-(methylthio)phenyl]methyl]acetamide