CAS 1353983-26-2

Phenylmethyl N-(4-mercaptocyclohexyl)carbamate

Description:

Phenylmethyl N-(4-mercaptocyclohexyl)carbamate is a chemical compound characterized by its unique structure, which includes a phenylmethyl group, a carbamate functional group, and a mercaptocyclohexyl moiety. This compound is likely to exhibit properties typical of carbamates, such as potential biological activity, including insecticidal or herbicidal effects, due to the presence of the mercapto group, which can enhance reactivity and interaction with biological targets. The presence of the cyclohexyl ring may contribute to its steric properties and influence its solubility and stability in various solvents. Additionally, the compound may exhibit specific interactions with enzymes or receptors, making it of interest in pharmaceutical or agrochemical research. Its safety profile, including toxicity and environmental impact, would need to be assessed through appropriate studies, as with any chemical substance. Overall, the characteristics of this compound suggest it may have applications in various fields, including medicinal chemistry and agricultural science.

Formula: C₁₄H₁₉NO₂S

InChI: InChI=1S/C14H19NO2S/c16-14(15-12-6-8-13(18)9-7-12)17-10-11-4-2-1-3-5-11/h1-5,12-13,18H,6-10H2,(H,15,16)

InChI key: InChIKey=KSTUXNJKFZJEIT-UHFFFAOYSA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)C2CCC(S)CC2

Synonyms:

• Carbamic acid, N-(4-mercaptocyclohexyl)-, phenylmethyl ester
• Phenylmethyl N-(4-mercaptocyclohexyl)carbamate