CymitQuimica logo

CAS 1353983-32-0

:

N-[1-(2-Aminoacetyl)-4-piperidinyl]-N-(1-methylethyl)acetamide

Description:
N-[1-(2-Aminoacetyl)-4-piperidinyl]-N-(1-methylethyl)acetamide, identified by its CAS number 1353983-32-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a piperidine ring and an acetamide functional group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of amino and carbonyl groups. Its piperidine moiety contributes to its basicity and potential pharmacological activity, making it of interest in medicinal chemistry. The presence of the aminoacetyl group suggests it may participate in various biochemical interactions, potentially influencing its biological activity. As with many compounds in this class, it may be subject to specific regulatory considerations depending on its intended use, particularly in pharmaceutical applications. Overall, its unique structural features position it as a candidate for further research in drug development and related fields.
Formula:C12H23N3O2
InChI:InChI=1S/C12H23N3O2/c1-9(2)15(10(3)16)11-4-6-14(7-5-11)12(17)8-13/h9,11H,4-8,13H2,1-3H3
InChI key:InChIKey=TYVYKBLZWNZYNJ-UHFFFAOYSA-N
SMILES:N(C(C)C)(C(C)=O)C1CCN(C(CN)=O)CC1
Synonyms:
  • N-[1-(2-Aminoacetyl)-4-piperidinyl]-N-(1-methylethyl)acetamide
  • Acetamide, N-[1-(2-aminoacetyl)-4-piperidinyl]-N-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.