CymitQuimica logo

CAS 1353983-46-6

:

4-[[Ethyl(phenylmethyl)amino]methyl]-1-piperidineethanol

Description:
4-[[Ethyl(phenylmethyl)amino]methyl]-1-piperidineethanol, identified by its CAS number 1353983-46-6, is a chemical compound that features a piperidine ring, which is a six-membered saturated heterocyclic structure containing one nitrogen atom. This compound is characterized by the presence of an ethyl group and a phenylmethyl group attached to an amino group, contributing to its potential biological activity. The hydroxyl group in the ethanol moiety suggests that it may exhibit polar characteristics, influencing its solubility in various solvents. The structural complexity of this compound indicates that it may interact with biological systems, potentially serving as a pharmacophore in medicinal chemistry. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall three-dimensional conformation of the molecule. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its chemical behavior and potential applications.
Formula:C17H28N2O
InChI:InChI=1S/C17H28N2O/c1-2-18(14-16-6-4-3-5-7-16)15-17-8-10-19(11-9-17)12-13-20/h3-7,17,20H,2,8-15H2,1H3
InChI key:InChIKey=DWBSPPGLQITDLM-UHFFFAOYSA-N
SMILES:C(N(CC1=CC=CC=C1)CC)C2CCN(CCO)CC2
Synonyms:
  • 4-[[Ethyl(phenylmethyl)amino]methyl]-1-piperidineethanol
  • 1-Piperidineethanol, 4-[[ethyl(phenylmethyl)amino]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.