CAS 1353983-78-4
:2-Chloro-N-(5-thiazolylmethyl)acetamide
Description:
2-Chloro-N-(5-thiazolylmethyl)acetamide is a chemical compound characterized by its thiazole ring and acetamide functional group. It features a chlorine atom attached to the second carbon of the acetamide moiety, which contributes to its reactivity and potential biological activity. The thiazole ring, a five-membered heterocyclic structure containing sulfur and nitrogen, enhances the compound's pharmacological properties, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amide group. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anti-inflammatory agents. The presence of the chlorine atom can influence the compound's lipophilicity and bioavailability. As with many thiazole derivatives, it may also exhibit unique interactions with biological targets, making it a candidate for further research in drug discovery and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C6H7ClN2OS
InChI:InChI=1S/C6H7ClN2OS/c7-1-6(10)9-3-5-2-8-4-11-5/h2,4H,1,3H2,(H,9,10)
InChI key:InChIKey=QGJGZJLVBLUGTK-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)C1=CN=CS1
Synonyms:- 2-Chloro-N-(5-thiazolylmethyl)acetamide
- Acetamide, 2-chloro-N-(5-thiazolylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
