CAS 1353984-20-9

Benzonitrile, 2-[(3-methyl-1-piperazinyl)methyl]-, hydrochloride (1:1)

Description:

Benzonitrile, 2-[(3-methyl-1-piperazinyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzonitrile moiety and a piperazine derivative. The presence of the piperazine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in medicinal chemistry. The compound may exhibit properties such as being a potential ligand for biological targets, and its piperazine component may influence its pharmacokinetic and pharmacodynamic profiles. Additionally, the presence of the nitrile group can impart unique reactivity and polarity characteristics. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a class of molecules that may have significant implications in drug development and therapeutic applications.

Formula: C₁₃H₁₇N₃·ClH

InChI: InChI=1S/C13H17N3.ClH/c1-11-9-16(7-6-15-11)10-13-5-3-2-4-12(13)8-14;/h2-5,11,15H,6-7,9-10H2,1H3;1H

InChI key: InChIKey=MNNCMIBBEMTJRS-UHFFFAOYSA-N

SMILES: C(C1=C(C#N)C=CC=C1)N2CC(C)NCC2.Cl

Synonyms:

• Benzonitrile, 2-[(3-methyl-1-piperazinyl)methyl]-, hydrochloride (1:1)

2-((3-Methylpiperazin-1-yl)methyl)benzonitrile hydrochloride

CAS: 1353984-20-9

2-((3-Methylpiperazin-1-yl)methyl)benzonitrile hydrochloride

Purity: 95%

Molecular weight: 251.76g/mol

Ref: 54-OR1050462