CAS 1353984-32-3: 1-(6-Ethoxy-4-pyrimidinyl)-3-piperidinecarboxylic acid

Description:1-(6-Ethoxy-4-pyrimidinyl)-3-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a piperidine moiety. The presence of the ethoxy group at the 6-position of the pyrimidine ring contributes to its lipophilicity, potentially enhancing its ability to penetrate biological membranes. The carboxylic acid functional group at the 3-position of the piperidine ring imparts acidic properties, allowing for potential interactions with biological targets, such as enzymes or receptors. This compound may exhibit pharmacological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, influencing its solubility and bioavailability. Additionally, the specific arrangement of atoms and functional groups may confer selectivity towards certain biological pathways, which is crucial for therapeutic applications. Overall, the characteristics of this compound make it a candidate for further investigation in the context of drug discovery and development.

Formula:C₁₂H₁₇N₃O₃

InChI:InChI=1S/C12H17N3O3/c1-2-18-11-6-10(13-8-14-11)15-5-3-4-9(7-15)12(16)17/h6,8-9H,2-5,7H2,1H3,(H,16,17)

InChI key:InChIKey=IVISBZMPQWVVOU-UHFFFAOYSA-N

SMILES:O=C(O)C1CN(C=2N=CN=C(OCC)C2)CCC1

Synonyms:
3-Piperidinecarboxylic acid, 1-(6-ethoxy-4-pyrimidinyl)-
1-(6-Ethoxy-4-pyrimidinyl)-3-piperidinecarboxylic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1-(6-Ethoxy-pyriMidin-4-yl)-piperidine-3-carboxylic acid REF: IN-DA009I0FCAS: 1353984-32-3	95%	158.00 €~266.00 €	Wed 16 Apr 25
1-(6-Ethoxy-pyrimidin-4-yl)-piperidine-3-carboxylic acid REF: 10-F088953CAS: 1353984-32-3	95.0%	To inquire	Mon 28 Apr 25
1-(6-Ethoxy-pyrimidin-4-yl)-piperidine-3-carboxylic acid REF: 3D-DEC98432CAS: 1353984-32-3	Min. 95%	- - -	Discontinued product