CAS 1353984-38-9

1,1-Dimethylethyl N-[1-(2-aminoacetyl)-3-piperidinyl]-N-ethylcarbamate

Description:

1,1-Dimethylethyl N-[1-(2-aminoacetyl)-3-piperidinyl]-N-ethylcarbamate, identified by its CAS number 1353984-38-9, is a chemical compound that features a complex structure incorporating a piperidine ring, an aminoacetyl group, and a carbamate functional group. This compound is characterized by its potential biological activity, which may include interactions with specific receptors or enzymes, making it of interest in pharmaceutical research. The presence of the dimethyl group contributes to its steric properties, potentially influencing its solubility and reactivity. The piperidine moiety is known for its role in various biological systems, often enhancing the compound's pharmacological profile. Additionally, the carbamate group can participate in hydrogen bonding, affecting the compound's stability and interaction with biological targets. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₄H₂₇N₃O₃

InChI: InChI=1S/C14H27N3O3/c1-5-17(13(19)20-14(2,3)4)11-7-6-8-16(10-11)12(18)9-15/h11H,5-10,15H2,1-4H3

InChI key: InChIKey=YBNKGLNUNYOZAN-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)(CC)C1CN(C(CN)=O)CCC1

Synonyms:

• 1,1-Dimethylethyl N-[1-(2-aminoacetyl)-3-piperidinyl]-N-ethylcarbamate
• Carbamic acid, N-[1-(2-aminoacetyl)-3-piperidinyl]-N-ethyl-, 1,1-dimethylethyl ester