CymitQuimica logo

CAS 1353984-47-0

:

2-Amino-N-methyl-N-[[1-(phenylmethyl)-2-piperidinyl]methyl]acetamide

Description:
2-Amino-N-methyl-N-[[1-(phenylmethyl)-2-piperidinyl]methyl]acetamide, identified by its CAS number 1353984-47-0, is a chemical compound characterized by its complex structure, which includes an amino group, a methyl group, and a piperidine ring. This compound typically exhibits properties associated with amides, such as potential solubility in polar solvents due to the presence of the amino and acetamide functional groups. The piperidine moiety contributes to its cyclic structure, which can influence its biological activity and interaction with various receptors. The presence of the phenylmethyl group may enhance lipophilicity, potentially affecting its pharmacokinetic properties. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its specific characteristics, such as melting point, boiling point, and reactivity, would require empirical data for precise determination, but its structural features suggest potential applications in drug design and synthesis.
Formula:C16H25N3O
InChI:InChI=1S/C16H25N3O/c1-18(16(20)11-17)13-15-9-5-6-10-19(15)12-14-7-3-2-4-8-14/h2-4,7-8,15H,5-6,9-13,17H2,1H3
InChI key:InChIKey=KBZJWKHZJFYMLV-UHFFFAOYSA-N
SMILES:C(N1C(CN(C(CN)=O)C)CCCC1)C2=CC=CC=C2
Synonyms:
  • Acetamide, 2-amino-N-methyl-N-[[1-(phenylmethyl)-2-piperidinyl]methyl]-
  • 2-Amino-N-methyl-N-[[1-(phenylmethyl)-2-piperidinyl]methyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.