CAS 1353984-92-5
:3-[[Cyclopropyl(phenylmethyl)amino]methyl]-1-pyrrolidineacetic acid
Description:
3-[[Cyclopropyl(phenylmethyl)amino]methyl]-1-pyrrolidineacetic acid, with the CAS number 1353984-92-5, is a chemical compound characterized by its unique structural features, including a pyrrolidine ring and a cyclopropyl group attached to a phenylmethyl amino moiety. This compound typically exhibits properties associated with amino acids, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of both amine and carboxylic acid functional groups. Its molecular structure suggests it may interact with biological systems, possibly acting as a ligand or modulator in pharmacological contexts. The presence of the cyclopropyl group may influence its steric and electronic properties, potentially affecting its reactivity and biological activity. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its identity and purity. Overall, this compound represents a class of molecules that could have applications in medicinal chemistry and drug development.
Formula:C17H24N2O2
InChI:InChI=1S/C17H24N2O2/c20-17(21)13-18-9-8-15(10-18)12-19(16-6-7-16)11-14-4-2-1-3-5-14/h1-5,15-16H,6-13H2,(H,20,21)
InChI key:InChIKey=ZBXQQJHMZLWEKY-UHFFFAOYSA-N
SMILES:N(CC1CN(CC(O)=O)CC1)(CC2=CC=CC=C2)C3CC3
Synonyms:- 3-[[Cyclopropyl(phenylmethyl)amino]methyl]-1-pyrrolidineacetic acid
- 1-Pyrrolidineacetic acid, 3-[[cyclopropyl(phenylmethyl)amino]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.