CAS 1353984-95-8

N-Cyclopropyl-N-[[1-(2-hydroxyethyl)-2-pyrrolidinyl]methyl]acetamide

Description:

N-Cyclopropyl-N-[[1-(2-hydroxyethyl)-2-pyrrolidinyl]methyl]acetamide, identified by its CAS number 1353984-95-8, is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with amides, such as moderate polarity and potential for hydrogen bonding due to the presence of the hydroxyl group. Its molecular structure suggests it may interact with biological systems, potentially influencing pharmacological activity. The presence of the cyclopropyl group can impart distinct steric and electronic properties, which may affect the compound's reactivity and binding affinity in biological contexts. Additionally, the hydroxyl group may enhance solubility in polar solvents. Overall, this compound's characteristics make it of interest in medicinal chemistry and drug development, particularly in the design of agents targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, as well as its biological activity.

Formula: C₁₂H₂₂N₂O₂

InChI: InChI=1S/C12H22N2O2/c1-10(16)14(11-4-5-11)9-12-3-2-6-13(12)7-8-15/h11-12,15H,2-9H2,1H3

InChI key: InChIKey=ISPYYRIUPAZBNC-UHFFFAOYSA-N

SMILES: N(CC1N(CCO)CCC1)(C(C)=O)C2CC2

Synonyms:

• N-Cyclopropyl-N-[[1-(2-hydroxyethyl)-2-pyrrolidinyl]methyl]acetamide
• Acetamide, N-cyclopropyl-N-[[1-(2-hydroxyethyl)-2-pyrrolidinyl]methyl]-