CymitQuimica logo

CAS 1353985-00-8

:

N-[(1-Acetyl-2-piperidinyl)methyl]-N-methylglycine

Description:
N-[(1-Acetyl-2-piperidinyl)methyl]-N-methylglycine, identified by its CAS number 1353985-00-8, is a chemical compound that features a piperidine ring, an acetyl group, and a glycine derivative. This compound is characterized by its molecular structure, which includes a piperidine moiety that contributes to its potential biological activity, particularly in the central nervous system. The presence of the acetyl group suggests that it may participate in various chemical reactions, including acylation processes. Additionally, the N-methylglycine component indicates that it may exhibit properties similar to amino acids, potentially influencing its solubility and reactivity in biological systems. The compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its biological activity, safety profile, and potential applications in therapeutic contexts. As with any chemical substance, proper handling and safety measures should be observed due to the potential for toxicity or adverse effects.
Formula:C11H20N2O3
InChI:InChI=1S/C11H20N2O3/c1-9(14)13-6-4-3-5-10(13)7-12(2)8-11(15)16/h10H,3-8H2,1-2H3,(H,15,16)
InChI key:InChIKey=VIDOAULAYMCFIS-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C(CN(CC(O)=O)C)CCCC1
Synonyms:
  • Glycine, N-[(1-acetyl-2-piperidinyl)methyl]-N-methyl-
  • N-[(1-Acetyl-2-piperidinyl)methyl]-N-methylglycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.