CAS 1353985-15-5
:N-[4-[Ethyl(2-hydroxyethyl)amino]cyclohexyl]acetamide
Description:
N-[4-[Ethyl(2-hydroxyethyl)amino]cyclohexyl]acetamide is a chemical compound characterized by its amide functional group, which is indicative of its potential as a pharmaceutical or biochemical agent. The structure features a cyclohexyl ring, providing a hydrophobic character, while the ethyl(2-hydroxyethyl)amino group introduces both hydrophilic and steric properties, which can influence its solubility and interaction with biological systems. This compound may exhibit various biological activities due to its ability to interact with specific receptors or enzymes, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas requiring modulation of biological pathways. The presence of the hydroxyl group enhances its polarity, potentially affecting its pharmacokinetics and bioavailability. As with many amides, it may also participate in hydrogen bonding, influencing its stability and reactivity. Overall, N-[4-[Ethyl(2-hydroxyethyl)amino]cyclohexyl]acetamide represents a complex molecule with diverse potential applications in research and industry.
Formula:C12H24N2O2
InChI:InChI=1S/C12H24N2O2/c1-3-14(8-9-15)12-6-4-11(5-7-12)13-10(2)16/h11-12,15H,3-9H2,1-2H3,(H,13,16)
InChI key:InChIKey=MJQGGMVCRKOAPE-UHFFFAOYSA-N
SMILES:N(CCO)(CC)C1CCC(NC(C)=O)CC1
Synonyms:- Acetamide, N-[4-[ethyl(2-hydroxyethyl)amino]cyclohexyl]-
- N-[4-[Ethyl(2-hydroxyethyl)amino]cyclohexyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.