CAS 1353985-25-7

3-[Cyclopropyl[(phenylmethoxy)carbonyl]amino]-1-pyrrolidineacetic acid

Description:

3-[Cyclopropyl[(phenylmethoxy)carbonyl]amino]-1-pyrrolidineacetic acid is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring, a cyclopropyl group, and a phenylmethoxycarbonyl moiety. This compound typically exhibits properties associated with amino acids, such as the ability to form hydrogen bonds due to the presence of both amino and carboxylic acid functional groups. The cyclopropyl group contributes to its unique steric and electronic properties, potentially influencing its biological activity and interaction with receptors or enzymes. The phenylmethoxycarbonyl group may enhance lipophilicity, affecting solubility and permeability. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its specific reactivity and stability would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other reactive species. Overall, this compound represents a class of molecules that could have significant implications in drug design and development.

Formula: C₁₇H₂₂N₂O₄

InChI: InChI=1S/C17H22N2O4/c20-16(21)11-18-9-8-15(10-18)19(14-6-7-14)17(22)23-12-13-4-2-1-3-5-13/h1-5,14-15H,6-12H2,(H,20,21)

InChI key: InChIKey=AFFVZVDFHIHCDO-UHFFFAOYSA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)(C2CN(CC(O)=O)CC2)C3CC3

Synonyms:

• 1-Pyrrolidineacetic acid, 3-[cyclopropyl[(phenylmethoxy)carbonyl]amino]-
• 3-[Cyclopropyl[(phenylmethoxy)carbonyl]amino]-1-pyrrolidineacetic acid