CAS 1353985-55-3
:N-[4-[(2-Aminoethyl)ethylamino]cyclohexyl]acetamide
Description:
N-[4-[(2-Aminoethyl)ethylamino]cyclohexyl]acetamide, identified by its CAS number 1353985-55-3, is a chemical compound characterized by its amide functional group and a cyclohexyl ring. This compound features a complex structure that includes an aminoethyl side chain, which contributes to its potential biological activity. The presence of multiple amine groups suggests that it may exhibit basic properties and could participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may be investigated for their pharmacological properties, potentially serving as intermediates in drug development or as active pharmaceutical ingredients. The cyclohexyl moiety may impart hydrophobic characteristics, affecting the compound's interaction with biological membranes. Additionally, the structural features may allow for various conformations, which can be crucial for its biological function. Overall, N-[4-[(2-Aminoethyl)ethylamino]cyclohexyl]acetamide represents a class of compounds that could have significant implications in medicinal chemistry and biochemistry.
Formula:C12H25N3O
InChI:InChI=1S/C12H25N3O/c1-3-15(9-8-13)12-6-4-11(5-7-12)14-10(2)16/h11-12H,3-9,13H2,1-2H3,(H,14,16)
InChI key:InChIKey=QJRZGGLOIWZAMR-UHFFFAOYSA-N
SMILES:N(CCN)(CC)C1CCC(NC(C)=O)CC1
Synonyms:- Acetamide, N-[4-[(2-aminoethyl)ethylamino]cyclohexyl]-
- N-[4-[(2-Aminoethyl)ethylamino]cyclohexyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.