CymitQuimica logo

CAS 1353985-72-4

:

2-[Cyclopropyl[(4-nitrophenyl)methyl]amino]ethanol

Description:
2-[Cyclopropyl[(4-nitrophenyl)methyl]amino]ethanol is a chemical compound characterized by its unique structure, which includes a cyclopropyl group, a nitrophenyl moiety, and an ethanolamine functional group. This compound features a cyclopropyl ring, contributing to its rigidity and potential for unique reactivity. The presence of the 4-nitrophenyl group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and solubility. The ethanolamine portion provides both basic and nucleophilic properties, making it potentially useful in various chemical reactions, including those involving amine functionalities. This compound may exhibit biological activity, as many amine-containing compounds are known for their pharmacological properties. Its specific interactions and applications would depend on further studies, including its solubility in different solvents, stability under various conditions, and potential uses in medicinal chemistry or as a synthetic intermediate. Overall, 2-[Cyclopropyl[(4-nitrophenyl)methyl]amino]ethanol represents a complex organic molecule with diverse potential applications in research and industry.
Formula:C12H16N2O3
InChI:InChI=1S/C12H16N2O3/c15-8-7-13(11-5-6-11)9-10-1-3-12(4-2-10)14(16)17/h1-4,11,15H,5-9H2
InChI key:InChIKey=ZPDXZCGATGXFEI-UHFFFAOYSA-N
SMILES:N(CC1=CC=C(N(=O)=O)C=C1)(CCO)C2CC2
Synonyms:
  • 2-[Cyclopropyl[(4-nitrophenyl)methyl]amino]ethanol
  • Ethanol, 2-[cyclopropyl[(4-nitrophenyl)methyl]amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.