CAS 1353985-82-6

3-[[Acetyl(1-methylethyl)amino]methyl]-1-pyrrolidineacetic acid

Description:

3-[[Acetyl(1-methylethyl)amino]methyl]-1-pyrrolidineacetic acid, with the CAS number 1353985-82-6, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and an acetic acid moiety. This compound features an acetyl group attached to a branched alkyl chain, specifically isopropyl, which contributes to its lipophilicity. The presence of the amino group allows for potential interactions with biological systems, making it of interest in pharmaceutical applications. The pyrrolidine ring provides a cyclic structure that can influence the compound's conformation and reactivity. Additionally, the compound may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its specific applications and biological activity would depend on further studies, including pharmacokinetics and mechanism of action, which are essential for understanding its potential therapeutic uses. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₂H₂₂N₂O₃

InChI: InChI=1S/C12H22N2O3/c1-9(2)14(10(3)15)7-11-4-5-13(6-11)8-12(16)17/h9,11H,4-8H2,1-3H3,(H,16,17)

InChI key: InChIKey=CMRBEQDGVGIAKW-UHFFFAOYSA-N

SMILES: C(N(C(C)C)C(C)=O)C1CN(CC(O)=O)CC1

Synonyms:

• 1-Pyrrolidineacetic acid, 3-[[acetyl(1-methylethyl)amino]methyl]-
• 3-[[Acetyl(1-methylethyl)amino]methyl]-1-pyrrolidineacetic acid