CAS 1353985-87-1

N-[2-(Acetylcyclopropylamino)cyclohexyl]glycine

Description:

N-[2-(Acetylcyclopropylamino)cyclohexyl]glycine, identified by its CAS number 1353985-87-1, is a chemical compound that features a cyclohexyl group and an acetylcyclopropylamino moiety attached to a glycine backbone. This compound is characterized by its potential biological activity, which may include interactions with specific receptors or enzymes, making it of interest in medicinal chemistry and pharmacology. The presence of the cyclopropyl and cyclohexyl groups contributes to its structural complexity and may influence its lipophilicity and solubility properties. Additionally, the acetyl group can affect the compound's reactivity and stability. As with many amino acid derivatives, it may exhibit properties such as zwitterionic behavior in solution, depending on the pH. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its potential applications could range from drug development to biochemical research. Further studies would be necessary to elucidate its specific mechanisms of action and therapeutic potential.

Formula: C₁₃H₂₂N₂O₃

InChI: InChI=1S/C13H22N2O3/c1-9(16)15(10-6-7-10)12-5-3-2-4-11(12)14-8-13(17)18/h10-12,14H,2-8H2,1H3,(H,17,18)

InChI key: InChIKey=LDYPIASWPBFTSL-UHFFFAOYSA-N

SMILES: N(C(C)=O)(C1C(NCC(O)=O)CCCC1)C2CC2

Synonyms:

• Glycine, N-[2-(acetylcyclopropylamino)cyclohexyl]-
• N-[2-(Acetylcyclopropylamino)cyclohexyl]glycine