CAS 1353985-94-0

2-[Cyclopropyl[2-(dimethylamino)cyclohexyl]amino]ethanol

Description:

2-[Cyclopropyl[2-(dimethylamino)cyclohexyl]amino]ethanol, identified by its CAS number 1353985-94-0, is a chemical compound characterized by its complex structure that includes a cyclopropyl group, a dimethylamino group, and an ethanol moiety. This compound features a secondary amine due to the presence of the dimethylamino group, which can influence its reactivity and interaction with biological systems. The cyclohexyl ring contributes to its hydrophobic characteristics, while the ethanol part introduces a hydroxyl group, enhancing its potential for hydrogen bonding. The presence of these functional groups suggests that the compound may exhibit interesting pharmacological properties, potentially acting as a ligand for various receptors. Its unique structure may also affect its solubility, stability, and overall behavior in different chemical environments. As with many compounds containing nitrogen and hydroxyl groups, it may participate in various chemical reactions, including alkylation and acylation, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₃H₂₆N₂O

InChI: InChI=1S/C13H26N2O/c1-14(2)12-5-3-4-6-13(12)15(9-10-16)11-7-8-11/h11-13,16H,3-10H2,1-2H3

InChI key: InChIKey=SQUWYBOMJCWVLV-UHFFFAOYSA-N

SMILES: N(CCO)(C1C(N(C)C)CCCC1)C2CC2

Synonyms:

• Ethanol, 2-[cyclopropyl[2-(dimethylamino)cyclohexyl]amino]-
• 2-[Cyclopropyl[2-(dimethylamino)cyclohexyl]amino]ethanol