CymitQuimica logo

CAS 1353986-02-3

:

2-Chloro-N-[1-(3-chlorophenyl)ethyl]-N-cyclopropylacetamide

Description:
2-Chloro-N-[1-(3-chlorophenyl)ethyl]-N-cyclopropylacetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent, an acetamide functional group, and a cyclopropyl moiety. This compound features a chiral center due to the presence of the ethyl group attached to a phenyl ring, which can influence its biological activity and interactions. The presence of chlorine atoms in the structure may enhance its lipophilicity and potentially affect its pharmacokinetic properties. As an acetamide derivative, it may exhibit various biological activities, making it of interest in medicinal chemistry. The compound's molecular interactions, solubility, and stability can be influenced by its functional groups and overall molecular geometry. Additionally, its CAS number, 1353986-02-3, allows for precise identification in chemical databases and literature. Overall, this compound's characteristics suggest potential applications in pharmaceutical research, particularly in the development of therapeutic agents.
Formula:C13H15Cl2NO
InChI:InChI=1S/C13H15Cl2NO/c1-9(10-3-2-4-11(15)7-10)16(12-5-6-12)13(17)8-14/h2-4,7,9,12H,5-6,8H2,1H3
InChI key:InChIKey=IICRSKCIAVZGPT-UHFFFAOYSA-N
SMILES:N(C(C)C1=CC(Cl)=CC=C1)(C(CCl)=O)C2CC2
Synonyms:
  • Acetamide, 2-chloro-N-[1-(3-chlorophenyl)ethyl]-N-cyclopropyl-
  • 2-Chloro-N-[1-(3-chlorophenyl)ethyl]-N-cyclopropylacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.