CAS 1353986-26-1
:2-Chloro-N-[(2-cyanophenyl)methyl]-N-methylacetamide
Description:
2-Chloro-N-[(2-cyanophenyl)methyl]-N-methylacetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro substituent, which contributes to its reactivity and potential biological activity. The presence of the cyanophenyl group indicates that it may exhibit unique electronic properties due to the cyano group, which can influence its interactions in biological systems. The N-methylacetamide portion suggests that it may participate in hydrogen bonding, affecting its solubility and stability. This compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals, given its structural complexity. Its molecular structure may allow for interactions with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties, including its reactivity, solubility, and biological effects.
Formula:C11H11ClN2O
InChI:InChI=1S/C11H11ClN2O/c1-14(11(15)6-12)8-10-5-3-2-4-9(10)7-13/h2-5H,6,8H2,1H3
InChI key:InChIKey=TZDQWVNZHULRND-UHFFFAOYSA-N
SMILES:C(N(C(CCl)=O)C)C1=C(C#N)C=CC=C1
Synonyms:- Acetamide, 2-chloro-N-[(2-cyanophenyl)methyl]-N-methyl-
- 2-Chloro-N-[(2-cyanophenyl)methyl]-N-methylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.