CAS 1353986-31-8

1-[3-[(2-Aminoethyl)cyclopropylamino]-1-pyrrolidinyl]ethanone

Description:

1-[3-[(2-Aminoethyl)cyclopropylamino]-1-pyrrolidinyl]ethanone, identified by its CAS number 1353986-31-8, is a chemical compound that features a complex structure incorporating a pyrrolidine ring and a cyclopropyl group. This substance is characterized by its amine functional groups, which contribute to its potential biological activity. The presence of the ethanone moiety suggests that it may exhibit ketone-like reactivity, influencing its interactions in biological systems. The compound's molecular structure indicates it may participate in hydrogen bonding due to the amino groups, which can enhance its solubility in polar solvents. Additionally, the cyclopropyl group may impart unique steric and electronic properties, potentially affecting its pharmacological profile. While specific data on its biological activity may not be widely available, compounds with similar structural features often exhibit significant interactions with various biological targets, making them of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₁₁H₂₁N₃O

InChI: InChI=1S/C11H21N3O/c1-9(15)13-6-4-11(8-13)14(7-5-12)10-2-3-10/h10-11H,2-8,12H2,1H3

InChI key: InChIKey=MVHUJJUHDDLCOZ-UHFFFAOYSA-N

SMILES: N(CCN)(C1CN(C(C)=O)CC1)C2CC2

Synonyms:

• 1-[3-[(2-Aminoethyl)cyclopropylamino]-1-pyrrolidinyl]ethanone
• Ethanone, 1-[3-[(2-aminoethyl)cyclopropylamino]-1-pyrrolidinyl]-