CAS 1353986-89-6

2-Amino-N-methyl-N-[(1-methyl-2-piperidinyl)methyl]acetamide

Description:

2-Amino-N-methyl-N-[(1-methyl-2-piperidinyl)methyl]acetamide is a chemical compound characterized by its amide functional group, which is indicative of its potential as a pharmacological agent. The presence of an amino group suggests that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The N-methyl and piperidinyl moieties contribute to its lipophilicity, which may influence its ability to cross biological membranes. This compound is likely to exhibit basic properties due to the presence of the amino group, making it a potential candidate for various biological interactions. Its structural complexity, including the piperidine ring, may also impart unique steric and electronic properties, affecting its reactivity and interaction with biological targets. As with many amides, it may be stable under physiological conditions but could undergo hydrolysis in the presence of strong acids or bases. Overall, the characteristics of this compound suggest potential applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways.

Formula: C₁₀H₂₁N₃O

InChI: InChI=1S/C10H21N3O/c1-12-6-4-3-5-9(12)8-13(2)10(14)7-11/h9H,3-8,11H2,1-2H3

InChI key: InChIKey=GKJNUQYQTOCEDM-UHFFFAOYSA-N

SMILES: C(N(C(CN)=O)C)C1N(C)CCCC1

Synonyms:

• 2-Amino-N-methyl-N-[(1-methyl-2-piperidinyl)methyl]acetamide
• Acetamide, 2-amino-N-methyl-N-[(1-methyl-2-piperidinyl)methyl]-