CAS 1353986-93-2

1,1-Dimethylethyl N-(1-methylethyl)-N-(3-pyrrolidinylmethyl)carbamate

Description:

1,1-Dimethylethyl N-(1-methylethyl)-N-(3-pyrrolidinylmethyl)carbamate, identified by its CAS number 1353986-93-2, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by the presence of a carbamate functional group, which is known for its applications in various fields, including agriculture and pharmaceuticals. The compound exhibits a combination of aliphatic and heterocyclic components, with a pyrrolidine ring contributing to its potential biological activity. Its molecular structure suggests that it may possess specific interactions with biological targets, making it of interest for research in medicinal chemistry. Additionally, the presence of dimethyl and isopropyl groups may influence its solubility and stability in different environments. As with many carbamates, it is essential to handle this compound with care due to potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties, including its reactivity, pharmacokinetics, and potential applications.

Formula: C₁₃H₂₆N₂O₂

InChI: InChI=1S/C13H26N2O2/c1-10(2)15(9-11-6-7-14-8-11)12(16)17-13(3,4)5/h10-11,14H,6-9H2,1-5H3

InChI key: InChIKey=GFOHWUANGLHYFD-UHFFFAOYSA-N

SMILES: C(N(C(OC(C)(C)C)=O)C(C)C)C1CCNC1

Synonyms:

• 1,1-Dimethylethyl N-(1-methylethyl)-N-(3-pyrrolidinylmethyl)carbamate
• Carbamic acid, N-(1-methylethyl)-N-(3-pyrrolidinylmethyl)-, 1,1-dimethylethyl ester