CymitQuimica logo

CAS 1353986-96-5

:

2-Amino-1-[2-(methoxymethyl)-1-pyrrolidinyl]ethanone

Description:
2-Amino-1-[2-(methoxymethyl)-1-pyrrolidinyl]ethanone is a chemical compound characterized by its unique structure, which includes an amino group and a pyrrolidine ring. This compound features a methoxymethyl substituent that enhances its solubility and reactivity. It is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the amino and methoxy groups. The compound may exhibit basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets. Safety data and handling precautions should be considered, as with any chemical substance, to mitigate risks associated with its use. Overall, 2-Amino-1-[2-(methoxymethyl)-1-pyrrolidinyl]ethanone represents a versatile compound with potential utility in various chemical and biological applications.
Formula:C8H16N2O2
InChI:InChI=1S/C8H16N2O2/c1-12-6-7-3-2-4-10(7)8(11)5-9/h7H,2-6,9H2,1H3
InChI key:InChIKey=GLGUFUFMSZIWPD-UHFFFAOYSA-N
SMILES:C(OC)C1N(C(CN)=O)CCC1
Synonyms:
  • Ethanone, 2-amino-1-[2-(methoxymethyl)-1-pyrrolidinyl]-
  • 2-Amino-1-[2-(methoxymethyl)-1-pyrrolidinyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.