CAS 1353987-02-6
:N-(1-Methylethyl)-N-(2-pyrrolidinylmethyl)acetamide
Description:
N-(1-Methylethyl)-N-(2-pyrrolidinylmethyl)acetamide, identified by its CAS number 1353987-02-6, is a chemical compound that features a unique structure combining an acetamide group with a branched alkyl chain and a pyrrolidine moiety. This compound is characterized by its amide functional group, which typically imparts properties such as moderate polarity and the ability to participate in hydrogen bonding. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic characteristics, while the pyrrolidine ring enhances its potential for interaction with biological systems, possibly influencing its pharmacological properties. The compound may exhibit solubility in organic solvents and limited solubility in water, typical of many amides. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the combination of hydrophobic and polar characteristics can be advantageous for drug design. Further studies would be necessary to fully elucidate its biological activity and potential uses.
Formula:C10H20N2O
InChI:InChI=1S/C10H20N2O/c1-8(2)12(9(3)13)7-10-5-4-6-11-10/h8,10-11H,4-7H2,1-3H3
InChI key:InChIKey=JUGHPRHGBYUZAJ-UHFFFAOYSA-N
SMILES:N(CC1CCCN1)(C(C)C)C(C)=O
Synonyms:- N-(1-Methylethyl)-N-(2-pyrrolidinylmethyl)acetamide
- Acetamide, N-(1-methylethyl)-N-(2-pyrrolidinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.