CAS 1353987-28-6

3-[[(1,1-Dimethylethoxy)carbonyl]ethylamino]-1-pyrrolidineacetic acid

Description:

3-[[(1,1-Dimethylethoxy)carbonyl]ethylamino]-1-pyrrolidineacetic acid, with the CAS number 1353987-28-6, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring, an acetic acid moiety, and an ethylamino group. This compound features a dimethylethoxycarbonyl substituent, which contributes to its lipophilicity and potential biological activity. The presence of the pyrrolidine ring suggests that it may exhibit properties typical of cyclic amines, such as the ability to participate in hydrogen bonding and interact with biological targets. The acetic acid component indicates that it may exhibit acidic properties, which could influence its solubility and reactivity in various environments. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural features that could facilitate interactions with biological systems. However, specific biological activities, stability, and reactivity would require further investigation through experimental studies.

Formula: C₁₃H₂₄N₂O₄

InChI: InChI=1S/C13H24N2O4/c1-5-15(12(18)19-13(2,3)4)10-6-7-14(8-10)9-11(16)17/h10H,5-9H2,1-4H3,(H,16,17)

InChI key: InChIKey=XCBBALHAYUXVCC-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)(CC)C1CN(CC(O)=O)CC1

Synonyms:

• 1-Pyrrolidineacetic acid, 3-[[(1,1-dimethylethoxy)carbonyl]ethylamino]-
• 3-[[(1,1-Dimethylethoxy)carbonyl]ethylamino]-1-pyrrolidineacetic acid