CAS 1353987-36-6

N-Cyclopropyl-N-[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]glycine

Description:

N-Cyclopropyl-N-[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]glycine, identified by its CAS number 1353987-36-6, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a cyclopropyl group, which contributes to its unique steric and electronic properties, enhancing its potential biological activity. The presence of a pyrrolidine ring indicates that it may exhibit conformational flexibility, which can influence its interaction with biological targets. Additionally, the phenylmethyl group suggests potential for hydrophobic interactions, which can affect solubility and binding affinity. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, due to its structural resemblance to neurotransmitters or their analogs. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.

Formula: C₁₇H₂₄N₂O₂

InChI: InChI=1S/C17H24N2O2/c20-17(21)13-19(15-8-9-15)12-16-7-4-10-18(16)11-14-5-2-1-3-6-14/h1-3,5-6,15-16H,4,7-13H2,(H,20,21)

InChI key: InChIKey=GUPGPRWNTRUAQX-UHFFFAOYSA-N

SMILES: C(N(CC(O)=O)C1CC1)C2N(CC3=CC=CC=C3)CCC2

Synonyms:

• Glycine, N-cyclopropyl-N-[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]-
• N-Cyclopropyl-N-[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]glycine