CAS 1353987-42-4
:N1-Cyclopropyl-N1-[[1-(phenylmethyl)-3-pyrrolidinyl]methyl]-1,2-ethanediamine
Description:
N1-Cyclopropyl-N1-[[1-(phenylmethyl)-3-pyrrolidinyl]methyl]-1,2-ethanediamine, identified by its CAS number 1353987-42-4, is a chemical compound characterized by its complex structure, which includes a cyclopropyl group, a pyrrolidine moiety, and an ethanediamine backbone. This compound is notable for its potential pharmacological properties, particularly in the context of neuropharmacology, where it may interact with various neurotransmitter systems. The presence of the cyclopropyl group can influence the compound's steric and electronic properties, potentially affecting its binding affinity and selectivity for specific receptors. Additionally, the phenylmethyl group contributes to the lipophilicity of the molecule, which can enhance its ability to cross biological membranes. As a result, this compound may be of interest in medicinal chemistry for the development of therapeutic agents targeting central nervous system disorders. However, detailed studies on its biological activity, toxicity, and pharmacokinetics are essential for understanding its full potential and safety profile.
Formula:C17H27N3
InChI:InChI=1S/C17H27N3/c18-9-11-20(17-6-7-17)14-16-8-10-19(13-16)12-15-4-2-1-3-5-15/h1-5,16-17H,6-14,18H2
InChI key:InChIKey=NQTLGKMIWNCZHI-UHFFFAOYSA-N
SMILES:N(CC1CN(CC2=CC=CC=C2)CC1)(CCN)C3CC3
Synonyms:- N1-Cyclopropyl-N1-[[1-(phenylmethyl)-3-pyrrolidinyl]methyl]-1,2-ethanediamine
- 1,2-Ethanediamine, N1-cyclopropyl-N1-[[1-(phenylmethyl)-3-pyrrolidinyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.