CAS 1353987-56-0

N-[(1-Acetyl-4-piperidinyl)methyl]glycine

Description:

N-[(1-Acetyl-4-piperidinyl)methyl]glycine, identified by its CAS number 1353987-56-0, is a chemical compound that features a piperidine ring substituted with an acetyl group and a glycine moiety. This compound is characterized by its potential biological activity, particularly in the context of pharmacology, where it may exhibit properties relevant to neuropharmacological research. The presence of the piperidine ring contributes to its ability to interact with various biological targets, while the glycine component may influence its solubility and reactivity. The compound is typically synthesized through organic reactions involving piperidine derivatives and acetylation processes. Its structural characteristics suggest that it may participate in hydrogen bonding and other intermolecular interactions, which can affect its stability and reactivity in different environments. As with many compounds in medicinal chemistry, understanding its pharmacokinetics and pharmacodynamics is crucial for evaluating its potential therapeutic applications. Safety and handling considerations are essential, as with any chemical substance, to mitigate risks associated with exposure.

Formula: C₁₀H₁₈N₂O₃

InChI: InChI=1S/C10H18N2O3/c1-8(13)12-4-2-9(3-5-12)6-11-7-10(14)15/h9,11H,2-7H2,1H3,(H,14,15)

InChI key: InChIKey=WEJPGSMFVONOMU-UHFFFAOYSA-N

SMILES: C(NCC(O)=O)C1CCN(C(C)=O)CC1

Synonyms:

• Glycine, N-[(1-acetyl-4-piperidinyl)methyl]-
• N-[(1-Acetyl-4-piperidinyl)methyl]glycine