CAS 1353988-00-7
:N-[2-[Cyclopropyl[(phenylmethoxy)carbonyl]amino]cyclohexyl]glycine
Description:
N-[2-[Cyclopropyl[(phenylmethoxy)carbonyl]amino]cyclohexyl]glycine, with CAS number 1353988-00-7, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a cyclohexyl group, which contributes to its structural complexity and may influence its biological activity. The presence of a cyclopropyl group and a phenylmethoxycarbonyl moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's structure indicates it may exhibit specific stereochemical properties, which can affect its pharmacodynamics and pharmacokinetics. Additionally, the incorporation of various functional groups implies that it could participate in hydrogen bonding and other intermolecular interactions, potentially enhancing its solubility and bioavailability. While specific data on its physical and chemical properties may not be readily available, compounds of this nature are often studied for their therapeutic potential, particularly in the context of neurological or psychiatric disorders. Further research would be necessary to elucidate its complete profile and applications.
Formula:C19H26N2O4
InChI:InChI=1S/C19H26N2O4/c22-18(23)12-20-16-8-4-5-9-17(16)21(15-10-11-15)19(24)25-13-14-6-2-1-3-7-14/h1-3,6-7,15-17,20H,4-5,8-13H2,(H,22,23)
InChI key:InChIKey=NZWJHYDZDSSJLX-UHFFFAOYSA-N
SMILES:N(C(OCC1=CC=CC=C1)=O)(C2C(NCC(O)=O)CCCC2)C3CC3
Synonyms:- N-[2-[Cyclopropyl[(phenylmethoxy)carbonyl]amino]cyclohexyl]glycine
- Glycine, N-[2-[cyclopropyl[(phenylmethoxy)carbonyl]amino]cyclohexyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.