CAS 1353988-06-3
:3-[[Cyclopropyl(phenylmethyl)amino]methyl]-1-pyrrolidineethanol
Description:
3-[[Cyclopropyl(phenylmethyl)amino]methyl]-1-pyrrolidineethanol, identified by its CAS number 1353988-06-3, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The structure includes a cyclopropyl group and a phenylmethyl moiety, indicating the presence of both aliphatic and aromatic characteristics. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds due to the presence of the hydroxyl group in the ethanol portion. Its unique structure may contribute to specific biological activities, making it of interest in medicinal chemistry. The presence of multiple functional groups suggests potential for diverse reactivity and interactions in various chemical environments. Additionally, the compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, as well as the presence of other solvents or reagents. Overall, this compound's characteristics make it a subject of interest for further research in pharmaceutical applications.
Formula:C17H26N2O
InChI:InChI=1S/C17H26N2O/c20-11-10-18-9-8-16(12-18)14-19(17-6-7-17)13-15-4-2-1-3-5-15/h1-5,16-17,20H,6-14H2
InChI key:InChIKey=SEASINYHCZQPHH-UHFFFAOYSA-N
SMILES:N(CC1CN(CCO)CC1)(CC2=CC=CC=C2)C3CC3
Synonyms:- 1-Pyrrolidineethanol, 3-[[cyclopropyl(phenylmethyl)amino]methyl]-
- 3-[[Cyclopropyl(phenylmethyl)amino]methyl]-1-pyrrolidineethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.